cas: 33243-33-3 — see every product listed under this CAS number, including other names
2',4'-Dibromoacetophenone, 98%, 98% (CAS 33243-33-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GQ2-100mg |
| cas | 33243-33-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 25g | 1480.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2,4-dibromophenyl)ethanone (CAS 33243-33-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,4-dibromophenyl)ethanone. InChIKey: PFNFQYGPUFVXPB-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,4-dibromophenyl)ethanone |
| InChIKey | PFNFQYGPUFVXPB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)