cas: 3669-41-8 — see every product listed under this CAS number, including other names
1-(2,4-Dihydroxyphenyl)-2-phenylethanone 98% (CAS 3669-41-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A554298-1g |
| cas | 3669-41-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 2400.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A554298 |
1-(2,4-dihydroxyphenyl)-2-phenylethanone (CAS 3669-41-8) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 1-(2,4-dihydroxyphenyl)-2-phenylethanone. InChIKey: VFQKAJVKZKHVPD-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 1-(2,4-dihydroxyphenyl)-2-phenylethanone |
| InChIKey | VFQKAJVKZKHVPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)