cas: 32937-55-6 — see every product listed under this CAS number, including other names
1-(2,5-Dibromophenyl)Ethanone, 97%, 97% (CAS 32937-55-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXD8-25g |
| cas | 32937-55-6 |
| size | 25g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3611.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 794.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2,5-dibromophenyl)ethanone (CAS 32937-55-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,5-dibromophenyl)ethanone. InChIKey: QFXROJNBTPMHSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,5-dibromophenyl)ethanone |
| InChIKey | QFXROJNBTPMHSS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)