cas: 32937-55-6 — see every product listed under this CAS number, including other names
1-(2,5-Dibromophenyl)ethanone, 95-<97% (CAS 32937-55-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5378-95-97-10g |
| cas | 32937-55-6 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 4116.86 Pln | |
| Hoffman Fine Chemicals | 25g | 7932.10 Pln | |
| Hoffman Fine Chemicals | 50g | 12506.56 Pln | |
| Hoffman Fine Chemicals | 100g | 19818.04 Pln | |
| Hoffman Fine Chemicals | 200g | 33477.62 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(2,5-dibromophenyl)ethanone (CAS 32937-55-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,5-dibromophenyl)ethanone. InChIKey: QFXROJNBTPMHSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,5-dibromophenyl)ethanone |
| InChIKey | QFXROJNBTPMHSS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)