1-(2,5-Dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95%
cas: 96604-24-9 — see every product listed under this CAS number, including other names
1-(2,5-Dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95% (CAS 96604-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1019880-250mg |
| cas | 96604-24-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4308.62 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1369.54 Pln | |
| BLDpharm | 5g | 4640.61 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 947.60 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1320.39 Pln | |
| Fluorochem | 5g | 4402.63 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 96604-24-9) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: YYVRLHVUPJBXRX-AATRIKPKSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | YYVRLHVUPJBXRX-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)