Products 96604-24-9
CAS 96604-24-9 is the registry number for 1-(2,5-Dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 96604-24-9) is a chemical compound with the molecular formula C11H11Cl2NO and a molecular weight of 244.11 g/mol. IUPAC name: (E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: YYVRLHVUPJBXRX-AATRIKPKSA-N.
| Molecular formula | C11H11Cl2NO |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (E)-1-(2,5-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | YYVRLHVUPJBXRX-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)