cas: 214262-96-1 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)cyclopentanecarboxylic acid, 96%, 96% (CAS 214262-96-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1183DX-250mg |
| cas | 214262-96-1 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 813.20 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 25g | 2805.20 Pln | |
| Chemat | 100g | 7355.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
1-(2-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214262-96-1) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: AXWFKNJZMNAYGJ-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | AXWFKNJZMNAYGJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)