cas: 1834-91-9 — see every product listed under this CAS number, including other names
1-(2-Hydroxy-4-nitrophenyl)ethanone, 95% (CAS 1834-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F759759-100MG |
| cas | 1834-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2361.69 Pln | |
| Fluorochem | 250mg | 3501.91 Pln | |
| Fluorochem | 1g | 6922.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-hydroxy-4-nitrophenyl)ethanone (CAS 1834-91-9) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(2-hydroxy-4-nitrophenyl)ethanone. InChIKey: MBWXEEAWDJCUKX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(2-hydroxy-4-nitrophenyl)ethanone |
| InChIKey | MBWXEEAWDJCUKX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)