CAS 20332-16-5 appears in our catalog under these names: 6-Amino-1,3-benzodioxole-5-carboxylic acid, 97%, 6-Aminobenzo(d)(1,3)dioxole-5-carboxylic acid, 6-Aminobenzo[d][1,3]dioxole-5-carboxylic acid 97%, 6-Aminobenzo[d][1,3]dioxole-5-carboxylic acid, 97%, 97%, 6-Aminobenzo[d][1,3]dioxole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 2,5g.
6-amino-1,3-benzodioxole-5-carboxylic acid (CAS 20332-16-5) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 6-amino-1,3-benzodioxole-5-carboxylic acid. InChIKey: OJTOAMSTANUUMJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 6-amino-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | OJTOAMSTANUUMJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)N |
Computed by PubChem (NCBI)