cas: 3114-30-5 — see every product listed under this CAS number, including other names
1-(3,4-Dibromophenyl)ethanone, 97%, 97% (CAS 3114-30-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C272-100mg |
| cas | 3114-30-5 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 500mg | 784.40 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 3578.00 Pln | |
| Chemat | 10g | 5814.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3,4-dibromophenyl)ethanone (CAS 3114-30-5) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(3,4-dibromophenyl)ethanone. InChIKey: GYWFVNMZKBLMAR-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(3,4-dibromophenyl)ethanone |
| InChIKey | GYWFVNMZKBLMAR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)Br |
Computed by PubChem (NCBI)