cas: 3114-30-5 — see every product listed under this CAS number, including other names
1-(3,4-Dibromophenyl)ethanone, 97% (CAS 3114-30-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A333973-10g |
| cas | 3114-30-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11495.05 Pln | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 500mg | 289.50 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 2.5g | 1179.81 Pln | |
| Fluorochem | 5g | 2294.00 Pln | |
| Fluorochem | 10g | 4485.94 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3,4-dibromophenyl)ethanone (CAS 3114-30-5) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(3,4-dibromophenyl)ethanone. InChIKey: GYWFVNMZKBLMAR-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(3,4-dibromophenyl)ethanone |
| InChIKey | GYWFVNMZKBLMAR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)Br |
Computed by PubChem (NCBI)