cas: 91252-27-6 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxyphenyl)ethanamine hydrochloride, 97% (CAS 91252-27-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689812-1G |
| cas | 91252-27-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 2.5g | 508.17 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 10g | 1539.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 91252-27-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)