cas: 14401-73-1 — see every product listed under this CAS number, including other names
1-(3,5-Dibromophenyl)ethanone, 95% (CAS 14401-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224466-1G |
| cas | 14401-73-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 128.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(3,5-dibromophenyl)ethanone (CAS 14401-73-1) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(3,5-dibromophenyl)ethanone. InChIKey: NHFJDRRYVMJBRJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)ethanone |
| InChIKey | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)