cas: 14401-73-1 — see every product listed under this CAS number, including other names
1-(3,5-dibromophenyl)ethanone, 97%, 97% (CAS 14401-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ISN-1g |
| cas | 14401-73-1 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 500g | 4195.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3,5-dibromophenyl)ethanone (CAS 14401-73-1) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(3,5-dibromophenyl)ethanone. InChIKey: NHFJDRRYVMJBRJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)ethanone |
| InChIKey | NHFJDRRYVMJBRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)Br)Br |
Computed by PubChem (NCBI)