cas: 842169-71-5 — see every product listed under this CAS number, including other names
1-(3-Bromo-phenyl)-2,2,2-trifluoro-ethylamine hydrochloride, 98%, 98% (CAS 842169-71-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G977-50mg |
| cas | 842169-71-5 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 611.60 Pln | |
| Chemat | 100mg | 717.20 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 500mg | 1528.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-71-5) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)