cas: 842169-71-5 — see every product listed under this CAS number, including other names
1-(3-Bromo-phenyl)-2,2,2-trifluoro-ethylamine hydrochloride, 98% (CAS 842169-71-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A906397-1g |
| cas | 842169-71-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3474.73 Pln | |
| AmBeed | 50mg | 987.91 Pln | |
| Fluorochem | 50mg | 435.28 Pln | |
| Fluorochem | 100mg | 653.95 Pln | |
| Fluorochem | 250mg | 1153.78 Pln | |
| Fluorochem | 500mg | 1919.13 Pln | |
| Fluorochem | 1g | 2444.99 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-71-5) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: DRGOYEFQAGQGHF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | DRGOYEFQAGQGHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)