cas: 1002356-02-6 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)-2,2-difluoroethanone, 95%, 95% (CAS 1002356-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H07Y-100mg |
| cas | 1002356-02-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1269.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-bromophenyl)-2,2-difluoroethanone (CAS 1002356-02-6) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluoroethanone. InChIKey: HZELFBPCXLKNMP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-difluoroethanone |
| InChIKey | HZELFBPCXLKNMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C(F)F |
Computed by PubChem (NCBI)