CAS 56159-89-8 appears in our catalog under these names: 2,6-Difluorophenacyl bromide 97%, 2-Bromo-1-(2,6-difluorophenyl)ethanone, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-bromo-1-(2,6-difluorophenyl)ethanone (CAS 56159-89-8) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 2-bromo-1-(2,6-difluorophenyl)ethanone. InChIKey: UZKLFNHMBFDXEN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2-bromo-1-(2,6-difluorophenyl)ethanone |
| InChIKey | UZKLFNHMBFDXEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)CBr)F |
Computed by PubChem (NCBI)