CAS 1600511-63-4 appears in our catalog under these names: 1-(5-Bromo-2,3-difluorophenyl)ethanone, 98%, 1-(5-Bromo-2,3-difluorophenyl)ethanone. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
1-(5-bromo-2,3-difluorophenyl)ethanone (CAS 1600511-63-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(5-bromo-2,3-difluorophenyl)ethanone. InChIKey: VOBVHTSZADQBLD-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(5-bromo-2,3-difluorophenyl)ethanone |
| InChIKey | VOBVHTSZADQBLD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Br)F)F |
Computed by PubChem (NCBI)