1-(3-Chloro-4-fluorophenyl)propan-1-one, 95+%
cas: 194943-82-3 — see every product listed under this CAS number, including other names
1-(3-Chloro-4-fluorophenyl)propan-1-one, 95+% (CAS 194943-82-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A766872-250mg |
| cas | 194943-82-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 403.22 Pln | |
| BLDpharm | 5g | 908.59 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1566.80 Pln | |
| Fluorochem | 5g | 2918.78 Pln | |
| Fluorochem | 10g | 5443.93 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-(3-chloro-4-fluorophenyl)propan-1-one (CAS 194943-82-3) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)propan-1-one. InChIKey: LHPIDZXCWYJUDU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)propan-1-one |
| InChIKey | LHPIDZXCWYJUDU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)