CAS 1017779-67-7 appears in our catalog under these names: 4'-Chloro-3'-fluoropropiophenone, 95%, 1-(4-Chloro-3-fluorophenyl)propan-1-one 95+%, 1-(4-Chloro-3-fluorophenyl)propan-1-one, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
1-(4-chloro-3-fluorophenyl)propan-1-one (CAS 1017779-67-7) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)propan-1-one. InChIKey: FNPWFFVVAPSNJH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)propan-1-one |
| InChIKey | FNPWFFVVAPSNJH-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)