Products 2560594-04-7

CAS 2560594-04-7 is the registry number for 3-(4-Chlorophenyl)propanoyl fluoride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(4-chlorophenyl)propanoyl fluoride (CAS 2560594-04-7) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 3-(4-chlorophenyl)propanoyl fluoride. InChIKey: HZYOSBKQJSAIPB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClFO
Molecular weight186.61 g/mol
IUPAC name3-(4-chlorophenyl)propanoyl fluoride
InChIKeyHZYOSBKQJSAIPB-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CCC(=O)F)Cl

Computed by PubChem (NCBI)