Products 186685-49-4
CAS 186685-49-4 appears in our catalog under these names: 4'-CHLORO-2'-FLUOROPROPIOPHENONE, 95%, 1–(4–Chloro–2–fluorophenyl)propan–1–one, 1-(4-Chloro-2-fluorophenyl)propan-1-one, 95%, 1-(4-Chloro-2-fluorophenyl)propan-1-one, 95+%, 1-(4-Chloro-2-fluorophenyl)propan-1-one 95+%. Offered by: Fluorochem, GLPBio, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 10g.
1-(4-chloro-2-fluorophenyl)propan-1-one (CAS 186685-49-4) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)propan-1-one. InChIKey: DKKIZMJWBRRHOG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)propan-1-one |
| InChIKey | DKKIZMJWBRRHOG-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)