CAS 261762-78-1 appears in our catalog under these names: 6'-Chloro-2'-fluoro-3'-methylacetophenone, 95%, 1-(6-Chloro-2-fluoro-3-methylphenyl)ethanone, 95+%, 1-(6-Chloro-2-fluoro-3-methylphenyl)ethanone, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
1-(6-chloro-2-fluoro-3-methylphenyl)ethanone (CAS 261762-78-1) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(6-chloro-2-fluoro-3-methylphenyl)ethanone. InChIKey: TYZFPTDLOTXWNZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(6-chloro-2-fluoro-3-methylphenyl)ethanone |
| InChIKey | TYZFPTDLOTXWNZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C(=O)C)F |
Computed by PubChem (NCBI)