CAS 81112-09-6 appears in our catalog under these names: 2-Chloro-4'-fluoropropiophenone, 95%, α–Chloro–4′–fluoropropiophenone, 2-Chloro-1-(4-fluorophenyl)propan-1-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g.
2-chloro-1-(4-fluorophenyl)propan-1-one (CAS 81112-09-6) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 2-chloro-1-(4-fluorophenyl)propan-1-one. InChIKey: AGQLOTJUTCKLOE-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 2-chloro-1-(4-fluorophenyl)propan-1-one |
| InChIKey | AGQLOTJUTCKLOE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)F)Cl |
Computed by PubChem (NCBI)