cas: 6613-64-5 — see every product listed under this CAS number, including other names
1-(3-SULFOPROPYL)-2-VINYLPYRIDINIUM BETAINE, 98% +(stabilized with TBC), 98% +(stabilized with TBC) (CAS 6613-64-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143IP-5g |
| cas | 6613-64-5 |
| size | 5g |
| availability | 681g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 50g | 458.00 Pln | |
| Chemat | 100g | 770.00 Pln | |
| Chemat | 250g | 1826.00 Pln | |
| Chemat | 500g | 3662.40 Pln |
| purity | 98% +(stabilized with TBC) |
|---|---|
| delivery time | 3 weeks |
3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate (CAS 6613-64-5) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate. InChIKey: DNHDSWZXBHTLDP-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate |
| InChIKey | DNHDSWZXBHTLDP-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=CC=[N+]1CCCS(=O)(=O)[O-] |
Computed by PubChem (NCBI)