cas: 6613-64-5 — see every product listed under this CAS number, including other names
3-(2-Vinylpyridin-1-ium-1-yl)propane-1-sulfonate 98% +(stabilized with TBC) (CAS 6613-64-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100250-10g |
| cas | 6613-64-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 398.19 Pln | |
| Ambeed | 100g | 1310.44 Pln | |
| Ambeed | 500g | 5181.94 Pln |
| purity | 98% +(stabilized with TBC) |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A100250 |
3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate (CAS 6613-64-5) is a chemical compound with the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. IUPAC name: 3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate. InChIKey: DNHDSWZXBHTLDP-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 3-(2-ethenylpyridin-1-ium-1-yl)propane-1-sulfonate |
| InChIKey | DNHDSWZXBHTLDP-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=CC=[N+]1CCCS(=O)(=O)[O-] |
Computed by PubChem (NCBI)