Products 1188086-34-1

CAS 1188086-34-1 is the registry number for 5-(3-(Trifluoromethyl)phenyl)isoxazole-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

5-[3-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid (CAS 1188086-34-1) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid. InChIKey: GHZGFZXDUYXVEW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO3
Molecular weight257.16 g/mol
IUPAC name5-[3-(trifluoromethyl)phenyl]-1,2-oxazole-3-carboxylic acid
InChIKeyGHZGFZXDUYXVEW-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(F)(F)F)C2=CC(=NO2)C(=O)O

Computed by PubChem (NCBI)