CAS 236736-23-5 appears in our catalog under these names: 2-Phenyl-5-trifluoromethyloxazole-4-carboxylic acid, 2-Phenyl-5-(trifluoromethyl)oxazole-4-carboxylic acid, 95%, 2–Phenyl–5–(trifluoromethyl)oxazole–4–carboxylic acid, 2-Phenyl-5-(trifluoromethyl)oxazole-4-carboxylic acid 95%. Offered by: Fluorochem, Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 236736-23-5) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: PYCFLCQAJFEELT-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | PYCFLCQAJFEELT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)