CAS 1963068-94-1 is the registry number for 5-Methyl-3-(2,4,5-trifluorophenyl)isoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid (CAS 1963068-94-1) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-methyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: OICRCDKJFCYDHK-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 5-methyl-3-(2,4,5-trifluorophenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | OICRCDKJFCYDHK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC(=C(C=C2F)F)F)C(=O)O |
Computed by PubChem (NCBI)