Products 253315-30-9

CAS 253315-30-9 is the registry number for 5-[3-(Trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid (CAS 253315-30-9) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid. InChIKey: CGOSBKOCNUXOHB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO3
Molecular weight257.16 g/mol
IUPAC name5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid
InChIKeyCGOSBKOCNUXOHB-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(F)(F)F)C2=C(N=CO2)C(=O)O

Computed by PubChem (NCBI)