CAS 253315-30-9 is the registry number for 5-[3-(Trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid (CAS 253315-30-9) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid. InChIKey: CGOSBKOCNUXOHB-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | CGOSBKOCNUXOHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)