Products 36303-10-3

CAS 36303-10-3 is the registry number for 4-Hydroxy-7-(trifluoromethyl)quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylic acid (CAS 36303-10-3) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylic acid. InChIKey: WIRWWNYJQQTWAH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6F3NO3
Molecular weight257.16 g/mol
IUPAC name4-oxo-7-(trifluoromethyl)-1H-quinoline-2-carboxylic acid
InChIKeyWIRWWNYJQQTWAH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(F)(F)F)NC(=CC2=O)C(=O)O

Computed by PubChem (NCBI)