cas: 1082-85-5 — see every product listed under this CAS number, including other names
1-(4-Acetylphenyl)-1H-pyrrole-2,5-dione 95+% (CAS 1082-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199569-250mg |
| cas | 1082-85-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 25g | 2556.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A199569 |
1-(4-acetylphenyl)pyrrole-2,5-dione (CAS 1082-85-5) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 1-(4-acetylphenyl)pyrrole-2,5-dione. InChIKey: ISGBKWSEHGAUNF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 1-(4-acetylphenyl)pyrrole-2,5-dione |
| InChIKey | ISGBKWSEHGAUNF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)