CAS 51362-30-2 appears in our catalog under these names: 3-(Pyridin-2-yloxy)benzoic acid, 3-(Pyrid-2-yloxy)benzoic acid, 95%, 3-(Pyridin-2-yloxy)benzoic acid, 98%, 3-(Pyrid-2-yloxy)benzoic acid, 95% . Offered by: Biosynth, Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 250mg, 2,5g, 1g, 100mg, 5g.
3-pyridin-2-yloxybenzoic acid (CAS 51362-30-2) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 3-pyridin-2-yloxybenzoic acid. InChIKey: LYSIEAIIZBZRCE-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 3-pyridin-2-yloxybenzoic acid |
| InChIKey | LYSIEAIIZBZRCE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)