CAS 923189-35-9 is the registry number for 4-(1,3-Benzoxazol-2-yl)-5-methylfuran-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(1,3-benzoxazol-2-yl)-5-methyl-3H-furan-2-one (CAS 923189-35-9) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4-(1,3-benzoxazol-2-yl)-5-methyl-3H-furan-2-one. InChIKey: QTDPBMLBWOODIE-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4-(1,3-benzoxazol-2-yl)-5-methyl-3H-furan-2-one |
| InChIKey | QTDPBMLBWOODIE-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=O)O1)C2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)