Products 500293-88-9
CAS 500293-88-9 appears in our catalog under these names: 2-Oxo-3-quinolin-2-ylpropanoic acid, 95%, 2-Oxo-3-(quinolin-2-yl)propanoic acid, 95%, 2-Quinolinepyruvic Acid. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-oxo-3-quinolin-2-ylpropanoic acid (CAS 500293-88-9) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-oxo-3-quinolin-2-ylpropanoic acid. InChIKey: PBCZPMGLYKFSIF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-oxo-3-quinolin-2-ylpropanoic acid |
| InChIKey | PBCZPMGLYKFSIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)CC(=O)C(=O)O |
Computed by PubChem (NCBI)