CAS 620-88-2 appears in our catalog under these names: 4-Nitrophenyl phenyl ether, 98%, 4–Nitrodiphenyl Ether, 4-Nitrodiphenyl Ether, >98.0%(GC), 4-NitroPhenyl Phenyl Ether, 98%, 98%, 1-Nitro-4-phenoxybenzene, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 250g.
1-nitro-4-phenoxybenzene (CAS 620-88-2) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 1-nitro-4-phenoxybenzene. InChIKey: JDTMUJBWSGNMGR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 1-nitro-4-phenoxybenzene |
| InChIKey | JDTMUJBWSGNMGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)