CAS 56162-63-1 appears in our catalog under these names: 2-Oxo-6-phenyl-1,2-dihydropyridine-3-carboxylic acid, 95%, 2-Oxo-6-Phenyl-1,2-Dihydro-3-Pyridinecarboxylic Acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-oxo-6-phenyl-1H-pyridine-3-carboxylic acid (CAS 56162-63-1) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-oxo-6-phenyl-1H-pyridine-3-carboxylic acid. InChIKey: MHFTTYLYTCCJGW-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-oxo-6-phenyl-1H-pyridine-3-carboxylic acid |
| InChIKey | MHFTTYLYTCCJGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)