CAS 60442-30-0 appears in our catalog under these names: 9-Methyl-4,9-dihydropyrano[3,4-b]indole-1,3-dione, 95%, 9-Methylpyrano(3,4-b)indole-1,3(4H,9H)-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
9-methyl-4H-pyrano[3,4-b]indole-1,3-dione (CAS 60442-30-0) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 9-methyl-4H-pyrano[3,4-b]indole-1,3-dione. InChIKey: SKOXVNIBOOHGLR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 9-methyl-4H-pyrano[3,4-b]indole-1,3-dione |
| InChIKey | SKOXVNIBOOHGLR-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C3=C1C(=O)OC(=O)C3 |
Computed by PubChem (NCBI)