cas: 123942-11-0 — see every product listed under this CAS number, including other names
1-(4-Bromo-2,5-difluorophenyl)ethanone 97% (CAS 123942-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A603685-250mg |
| cas | 123942-11-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 453.81 Pln | |
| Ambeed | 25g | 1977.94 Pln | |
| Ambeed | 100g | 6366.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A603685 |
1-(4-bromo-2,5-difluorophenyl)ethanone (CAS 123942-11-0) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)ethanone. InChIKey: JPTNTBSBJPCXGI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)ethanone |
| InChIKey | JPTNTBSBJPCXGI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)