cas: 123942-11-0 — see every product listed under this CAS number, including other names
1-(4-BROMO-2,5-DIFLUOROPHENYL)ETHANONE, 98% (CAS 123942-11-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467107-1G |
| cas | 123942-11-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 794.53 Pln | |
| Fluorochem | 25g | 1903.51 Pln | |
| Fluorochem | 100g | 4964.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromo-2,5-difluorophenyl)ethanone (CAS 123942-11-0) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)ethanone. InChIKey: JPTNTBSBJPCXGI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)ethanone |
| InChIKey | JPTNTBSBJPCXGI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)