cas: 123942-11-0 — see every product listed under this CAS number, including other names
1-(4-Bromo-2,5-difluorophenyl)ethanone, 98%, 98% (CAS 123942-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IIL-250mg |
| cas | 123942-11-0 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 1883.60 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 100g | 6347.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2,5-difluorophenyl)ethanone (CAS 123942-11-0) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromo-2,5-difluorophenyl)ethanone. InChIKey: JPTNTBSBJPCXGI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromo-2,5-difluorophenyl)ethanone |
| InChIKey | JPTNTBSBJPCXGI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)