CAS 336105-43-2 appears in our catalog under these names: (S)–1–(4–Bromophenyl)–2,2,2–trifluoroethanamine hydrochloride, Benzenemethanamine, 4-bromo-α-(trifluoromethyl)-, hydrochloride (1:1), (αS)-, 98%, 98%, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 95%, (S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 25g, 250mg, 500mg, 5g, 10g, 1g.
(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 336105-43-2) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: XESDERGPILUSRV-FJXQXJEOSA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1S)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | XESDERGPILUSRV-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)