CAS 842169-83-9 appears in our catalog under these names: (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 95%, (R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 842169-83-9) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: XESDERGPILUSRV-OGFXRTJISA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | XESDERGPILUSRV-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)