CAS 177211-26-6 appears in our catalog under these names: 4’-Chloro-2’-fluoro-5’-methylacetophenone (>90%), 1-(4-Chloro-2-fluoro-5-methylphenyl)ethanone, 95%, 95%, 4'-Chloro-2'-fluoro-5'-methylacetophenone, 95%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 250mg, 1g, 100mg, 10g.
1-(4-chloro-2-fluoro-5-methylphenyl)ethanone (CAS 177211-26-6) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(4-chloro-2-fluoro-5-methylphenyl)ethanone. InChIKey: NOYPJFRXHUSDQL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(4-chloro-2-fluoro-5-methylphenyl)ethanone |
| InChIKey | NOYPJFRXHUSDQL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)F)C(=O)C |
Computed by PubChem (NCBI)