1-(4-Chloro-2-fluorophenyl)propan-1-one, 95+%
cas: 186685-49-4 — see every product listed under this CAS number, including other names
1-(4-Chloro-2-fluorophenyl)propan-1-one, 95+% (CAS 186685-49-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: AmBeed, Chemat, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A544740-25g |
| cas | 186685-49-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 8415.82 Pln | |
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2562.00 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 909.20 Pln | |
| Chemat | 5g | 2570.00 Pln | |
| Chemat | 10g | 4072.40 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 475.41 Pln | |
| BLDpharm | 1g | 975.24 Pln | |
| BLDpharm | 5g | 2757.94 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-chloro-2-fluorophenyl)propan-1-one (CAS 186685-49-4) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)propan-1-one. InChIKey: DKKIZMJWBRRHOG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)propan-1-one |
| InChIKey | DKKIZMJWBRRHOG-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)