1-(4-Chloro-3-fluorophenyl)propan-1-one, 95+%
cas: 1017779-67-7 — see every product listed under this CAS number, including other names
1-(4-Chloro-3-fluorophenyl)propan-1-one, 95+% (CAS 1017779-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A615636-250mg |
| cas | 1017779-67-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1549.62 Pln | |
| Ambeed | 25g | 5109.62 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 928.40 Pln | |
| Chemat | 25g | 3011.60 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1669.44 Pln | |
| BLDpharm | 25g | 5501.42 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-chloro-3-fluorophenyl)propan-1-one (CAS 1017779-67-7) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)propan-1-one. InChIKey: FNPWFFVVAPSNJH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)propan-1-one |
| InChIKey | FNPWFFVVAPSNJH-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=C(C=C1)Cl)F |
Computed by PubChem (NCBI)