1-(4-Chlorophenyl)butane-1,3-dione, 98%
cas: 6302-55-2 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)butane-1,3-dione, 98% (CAS 6302-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A502660-100mg |
| cas | 6302-55-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 2250.50 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2258.00 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 2419.17 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-chlorophenyl)butane-1,3-dione (CAS 6302-55-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 1-(4-chlorophenyl)butane-1,3-dione. InChIKey: TVWDRSJRFMTIPQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)butane-1,3-dione |
| InChIKey | TVWDRSJRFMTIPQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(4-chlorophenyl)butane-1,3-dione, 1-(4-Chlorophenyl)1,3-butanedione, 1-(4-chlorophenyl)-1,3-butanedione, 1,3-Butanedione, 1-(4-chlorophenyl)-, p-Chlorbenzoylaceton, 1-(4-Chloro-phenyl)-butane-1,3-dione, p-chloro-benzoylacetone, 4-Chlorobenzoylacetone, TVWDRSJRFMTIPQ-UH, TVWDRSJRFMTIPQ-UHFFFAOYSA-N