CAS 6302-55-2 appears in our catalog under these names: 1-(4-Chlorophenyl)butane-1,3-dione, 97%, 1-(4-Chlorophenyl)butane-1,3-dione, 1-(4-Chlorophenyl)butane-1,3-dione, >98.0%(GC)(T), 1-(4-Chlorophenyl)butane-1,3-dione, 98.0%, 98.0%, 1-(4-chlorophenyl)-3-hydroxybut-2-en-1-one, 97%. Offered by: Combi-blocks, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 0,5g, 200mg.
1-(4-chlorophenyl)butane-1,3-dione (CAS 6302-55-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 1-(4-chlorophenyl)butane-1,3-dione. InChIKey: TVWDRSJRFMTIPQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 1-(4-chlorophenyl)butane-1,3-dione |
| InChIKey | TVWDRSJRFMTIPQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)