cas: 83882-67-1 — see every product listed under this CAS number, including other names
1-(4-Difluoromethoxy-phenyl)-ethanone, 97% (CAS 83882-67-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031720-5G |
| cas | 83882-67-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 279.09 Pln | |
| Fluorochem | 25g | 539.41 Pln | |
| Fluorochem | 100g | 1736.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(difluoromethoxy)phenyl]ethanone (CAS 83882-67-1) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-[4-(difluoromethoxy)phenyl]ethanone. InChIKey: GIGWRVLNOYPOIT-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-[4-(difluoromethoxy)phenyl]ethanone |
| InChIKey | GIGWRVLNOYPOIT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC(F)F |
Computed by PubChem (NCBI)